850568-41-1 Usage
General Description
(4-Acetamidomethylphenyl)boronic acid, also known as 4-((acetylamino)methyl)phenylboronic acid, is a chemical compound primarily used in the fields of pharmaceuticals, biochemistry and organic synthesis. As an organoboronic acid, it is characterized by the B(OH)2 group and forms stable covalent complexes with sugars, amino acids and hydroxamic acids. (4-ACETAMIDOMETHYLPHENYL)BORONIC ACID is often used as a reagent in various chemical reactions, including Suzuki coupling - a type of palladium-catalyzed cross-coupling reaction. Its ability to selectively interact with certain compounds makes it advantageous for the synthesis of different kinds of complex molecules, particularly in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-41-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850568-41:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*4)+(1*1)=181
181 % 10 = 1
So 850568-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BNO3/c1-7(12)11-6-8-2-4-9(5-3-8)10(13)14/h2-5,13-14H,6H2,1H3,(H,11,12)
