850568-57-9 Usage
General Description
(3-Nitro-4-isobutylphenyl)boronic acid is a chemical compound that belongs to the class of boronic acids. It is commonly used in organic synthesis as a building block for the preparation of various pharmaceuticals and bioactive compounds. (3-NITRO-4-ISOBUTYLPHENYL)BORONIC ACID is known for its ability to form stable complexes with diols, which makes it useful in the development of new drugs and materials. It is also used as a reagent in the Suzuki coupling reaction, a widely used method in organic synthesis to form carbon-carbon bonds. Additionally, (3-nitro-4-isobutylphenyl)boronic acid has been studied for its potential applications in medicinal chemistry and drug discovery due to its unique reactivity and structural properties.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 850568-57:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*5)+(1*7)=189
189 % 10 = 9
So 850568-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO4/c1-7(2)5-8-3-4-9(11(13)14)6-10(8)12(15)16/h3-4,6-7,13-14H,5H2,1-2H3