850568-63-7 Usage
Uses
Used in Organic Chemistry:
2-(E-Cyanovinyl)benzeneboronic acid is used as a reagent in various organic synthesis processes, particularly for the formation of carbon-carbon and carbon-heteroatom bonds.
Used in Medicinal Research:
In the field of medicinal research, 2-(E-Cyanovinyl)benzeneboronic acid is used as a building block for the synthesis of complex organic molecules, including pharmaceuticals.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
2-(E-Cyanovinyl)benzeneboronic acid is employed as a key component in Suzuki-Miyaura cross-coupling reactions, which are widely used in the synthesis of complex organic molecules, such as pharmaceuticals. This reaction allows for the formation of new carbon-carbon bonds, facilitating the creation of a diverse range of molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-63-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 850568-63:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*6)+(1*3)=187
187 % 10 = 7
So 850568-63-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BNO2/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-6,12-13H/b5-3-
