850568-68-2 Usage
Description
2-(4-Boronobenzene)-5,6-dihydro-4H-1,3-oxazine is a chemical compound characterized by the fusion of a boron-substituted benzene ring with a 1,3-oxazine ring. This unique structure endows the compound with distinctive properties, particularly the presence of the boron atom in the benzene ring, which makes it a promising candidate for various applications in organic chemistry, material synthesis, and pharmaceutical development.
Uses
Used in Organic Chemistry:
2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE is used as a synthetic intermediate for the development of novel organic compounds. The presence of the boron atom in the benzene ring allows for unique chemical reactions and transformations, facilitating the synthesis of new molecules with potential applications in various fields.
Used in Material Synthesis:
In the field of material science, 2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE is utilized as a building block for the creation of advanced materials. 2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE's structure and properties can be exploited to design and synthesize materials with specific characteristics, such as improved mechanical strength, thermal stability, or electrical conductivity.
Used in Pharmaceutical Development:
2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE is employed as a key component in the design and synthesis of new pharmaceutical agents. 2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE's unique structure and properties can be leveraged to develop drugs with enhanced efficacy, selectivity, and reduced side effects. The boron atom in the benzene ring may also facilitate targeted drug delivery and other advanced therapeutic strategies.
Used in Research and Development:
2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE is utilized as a subject of interest in scientific research and development. 2-(4-BORONOBENZENE)-5,6-DIHYDRO-4H-1,3-OXAZINE's unique structure and properties make it an attractive candidate for further investigation, potentially leading to new discoveries and applications in various industrial and scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-68-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 850568-68:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*6)+(1*8)=192
192 % 10 = 2
So 850568-68-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BNO3/c13-11(14)9-4-2-8(3-5-9)10-12-6-1-7-15-10/h2-5,13-14H,1,6-7H2