850568-71-7 Usage
Description
3-Quinolineboronic acid hydrochloride is a boronic acid derivative of quinoline, a heterocyclic compound with a broad spectrum of biological and pharmacological activities. As a chemical compound, it is extensively utilized in organic synthesis and pharmaceutical research. The hydrochloride salt form of this compound improves its solubility in water, facilitating its use in various aqueous applications. With its unique reactivity and diverse synthetic applications, 3-Quinolineboronic acid hydrochloride serves as a crucial building block in organic chemistry, playing a significant role in the synthesis of complex organic molecules, pharmaceutical drugs, agrochemicals, and materials for advanced technologies.
Uses
Used in Organic Synthesis:
3-Quinolineboronic acid hydrochloride is used as a synthetic building block for the creation of complex organic molecules. Its unique reactivity and versatile synthetic applications make it an essential component in the development of new organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Quinolineboronic acid hydrochloride is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its ability to form stable complexes with biological targets makes it a valuable tool in drug discovery and development.
Used in Agrochemical Development:
3-Quinolineboronic acid hydrochloride is employed as a precursor in the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals that can improve crop protection and yield.
Used in Advanced Technology Materials:
3-QUINOLINEBORONIC ACID HYDROCHLORIDE is also used as a building block for the development of materials for advanced technologies, such as sensors, electronic devices, and energy storage systems, due to its unique chemical properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-71-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850568-71:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*7)+(1*1)=187
187 % 10 = 7
So 850568-71-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BNO2.ClH/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8;/h1-6,12-13H;1H
