850568-75-1 Usage
Uses
Used in Synthetic Chemistry:
4-Hydroxy-3-nitrophenylboronic acid is used as a key intermediate in the synthesis of complex organic compounds, particularly through Suzuki-Miyaura coupling reactions. It facilitates the formation of carbon-carbon bonds, which are essential for creating a variety of organic molecules.
Used in the Development of Chemosensors:
4-Hydroxy-3-nitrophenylboronic acid is employed as a building block in the creation of chemosensors, which are devices that can detect and respond to specific chemical stimuli. Its unique chemical properties make it suitable for designing sensitive and selective sensors for various applications.
Used in the Production of Functional Materials:
4-Hydroxy-3-nitrophenylboronic acid is used as a component in the synthesis of functional materials, which possess specific properties that can be tailored for various applications, such as in electronics, energy storage, or catalysis.
Used in the Synthesis of Bioactive Molecules:
4-Hydroxy-3-nitrophenylboronic acid is utilized in the development of bioactive molecules, which are compounds that can interact with biological systems and have potential applications in medicine, such as in the creation of new drugs or therapeutic agents. Its versatility in chemical reactions allows for the exploration of novel bioactive compounds with potential therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-75-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 850568-75:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*7)+(1*5)=191
191 % 10 = 1
So 850568-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BNO5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9-11H
