850583-75-4 Usage
Description
3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is a heterocyclic organic compound characterized by its unique molecular structure, featuring two thiophene rings attached to a pyrrolo[3,4-c]pyrrole-1,4-dione core. 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione exhibits interesting electronic and optical properties, making it a promising candidate for various applications in materials science and organic chemistry.
Uses
Used in Organic Synthesis:
3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is used as a key intermediate in the synthesis of various organic compounds, particularly those with potential applications in pharmaceuticals, agrochemicals, and materials science. Its unique structure allows for versatile functionalization and modification, enabling the development of new molecules with tailored properties.
Used in the Suzuki Reaction:
In the field of cross-coupling reactions, 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is employed in the Suzuki reaction, a widely used method for the formation of carbon-carbon bonds. This reaction allows for the efficient and selective synthesis of complex organic molecules, including those with potential applications in medicinal chemistry and materials science.
Used in the Synthesis of Donor-Acceptor Polymers:
3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is used as a building block in the synthesis of donor-acceptor polymers, which are essential components in the development of advanced electronic materials. These polymers are utilized in polymer field-effect transistors and bulk heterojunction solar cells, where their unique electronic properties enable efficient charge transport and energy conversion.
Used in Electronics Industry:
In the electronics industry, 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is used as a component in the development of organic semiconductors, which are crucial for the fabrication of flexible and lightweight electronic devices. Its incorporation into these materials can enhance their performance, stability, and processability, making them suitable for a wide range of applications, including displays, sensors, and energy storage devices.
Check Digit Verification of cas no
The CAS Registry Mumber 850583-75-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,8 and 3 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 850583-75:
(8*8)+(7*5)+(6*0)+(5*5)+(4*8)+(3*3)+(2*7)+(1*5)=184
184 % 10 = 4
So 850583-75-4 is a valid CAS Registry Number.
InChI:1S/C14H8N2O2S2/c17-13-9-10(12(16-13)8-4-2-6-20-8)14(18)15-11(9)7-3-1-5-19-7/h1-6H,(H,15,18)(H,16,17)