850589-34-3 Usage
General Description
4-(2-Methoxyethylaminocarbonyl)benzeneboronic acid is a boronic acid derivative that contains a benzene ring with a carboxylic acid group and an amino group attached to it. The compound is commonly used in chemical research and drug development, particularly in the synthesis of pharmaceuticals. It is known for its ability to form stable complexes with diols and anions, making it a valuable tool in organic synthesis and medicinal chemistry. The compound's unique structure and reactivity make it a useful building block in the creation of biologically active molecules and potential drug candidates.
Check Digit Verification of cas no
The CAS Registry Mumber 850589-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,8 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 850589-34:
(8*8)+(7*5)+(6*0)+(5*5)+(4*8)+(3*9)+(2*3)+(1*4)=193
193 % 10 = 3
So 850589-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO4/c1-16-7-6-12-10(13)8-2-4-9(5-3-8)11(14)15/h2-5,14-15H,6-7H2,1H3,(H,12,13)
