850589-37-6 Usage
Description
3-Chloro-4-(hydrazinocarbonyl)benzeneboronic acid is a boronic acid derivative with the molecular formula C7H7BClNO3. It is an important chemical compound used in organic synthesis and pharmaceutical research due to its ability to form stable complexes with diols and other Lewis bases. This property makes it a valuable reagent in cross-coupling reactions and a building block for the preparation of various biologically active compounds, including potential anticancer and antiviral agents. Furthermore, it has been investigated for its potential applications in materials science and catalysis, showcasing its versatility in the chemical and pharmaceutical industries.
Uses
Used in Organic Synthesis:
3-Chloro-4-(hydrazinocarbonyl)benzeneboronic acid is used as a reagent in cross-coupling reactions for the formation of stable complexes with diols and other Lewis bases. This application is crucial in the synthesis of complex organic molecules and the development of new chemical compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Chloro-4-(hydrazinocarbonyl)benzeneboronic acid serves as a building block in the preparation of biologically active compounds. Its potential as an anticancer and antiviral agent makes it a promising candidate for the development of new drugs and therapeutic agents.
Used in Materials Science:
3-Chloro-4-(hydrazinocarbonyl)benzeneboronic acid has been investigated for its potential applications in materials science. Its ability to form stable complexes with various compounds can contribute to the development of new materials with unique properties and applications.
Used in Catalysis:
3-Chloro-4-(hydrazinocarbonyl)benzeneboronic acid has also been explored for its potential use in catalysis. Its ability to form stable complexes with Lewis bases can be leveraged to enhance the efficiency and selectivity of catalytic processes in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 850589-37-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,8 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 850589-37:
(8*8)+(7*5)+(6*0)+(5*5)+(4*8)+(3*9)+(2*3)+(1*7)=196
196 % 10 = 6
So 850589-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BClN2O3/c9-6-3-4(8(13)14)1-2-5(6)7(12)11-10/h1-3,13-14H,10H2,(H,11,12)