850589-41-2

Usage

Uses

Used in Organic Synthesis:
3-CHLORO-4-(N-ISOPROPYLCARBAMOYL)PHENYLBORONIC ACID is used as a reagent in organic synthesis for its ability to participate in the Suzuki-Miyaura cross-coupling reaction. This reaction is a widely used method for forming carbon-carbon bonds, which is crucial for the creation of complex organic molecules.
Used in Pharmaceutical Research:
In pharmaceutical research, 3-CHLORO-4-(N-ISOPROPYLCARBAMOYL)PHENYLBORONIC ACID serves as a building block for the synthesis of various biologically active molecules. Its unique structure allows it to be a key component in the development of new pharmaceuticals, potentially leading to the discovery of novel treatments and therapies.
Used in Agrochemicals Synthesis:
3-CHLORO-4-(N-ISOPROPYLCARBAMOYL)PHENYLBORONIC ACID is also utilized in the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals that can improve crop yields and protect plants from pests and diseases.
Used in Materials Science:
In the field of materials science, 3-CHLORO-4-(N-ISOPROPYLCARBAMOYL)PHENYLBORONIC ACID has potential applications due to its unique reactivity. It can be incorporated into the development of new materials with specific properties, such as improved strength, flexibility, or chemical resistance.
Used in Catalysis:
3-CHLORO-4-(N-ISOPROPYLCARBAMOYL)PHENYLBORONIC ACID's versatility in chemical reactions makes it a candidate for use in catalysis. It can potentially serve as a catalyst or be used in the development of new catalytic systems to enhance the efficiency and selectivity of various chemical processes.

InChI:InChI=1/C10H13BClNO3/c1-6(2)13-10(14)8-4-3-7(11(15)16)5-9(8)12/h3-6,15-16H,1-2H3,(H,13,14)