850589-49-0 Usage
Description
3-Chloro-4-(morpholine-4-carbonyl)benzeneboronic acid is a boronic acid derivative featuring a chloro group and a morpholine-4-carbonyl group attached to a benzene ring. It is a versatile chemical compound widely used in organic synthesis and medicinal chemistry due to its reactivity and capacity to form stable complexes with other molecules. 3-CHLORO-4-(MORPHOLINE-4-CARBONYL)BENZENEBORONIC ACID has also demonstrated potential biological activities, positioning it as a promising building block for the development of new pharmaceuticals and biologically active molecules.
Uses
Used in Organic Synthesis:
3-Chloro-4-(morpholine-4-carbonyl)benzeneboronic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for a range of chemical reactions, facilitating the creation of diverse molecules with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-chloro-4-(morpholine-4-carbonyl)benzeneboronic acid is utilized as a starting material for the development of pharmaceuticals. Its reactivity and ability to form stable complexes make it an ideal candidate for the construction of drug molecules with targeted therapeutic effects.
Used in Drug Discovery:
3-Chloro-4-(morpholine-4-carbonyl)benzeneboronic acid is employed as a building block in drug discovery processes. Its potential biological activities and compatibility with other molecular structures make it a valuable component in the design and synthesis of new drugs with improved efficacy and selectivity.
Used in the Development of Biologically Active Molecules:
3-CHLORO-4-(MORPHOLINE-4-CARBONYL)BENZENEBORONIC ACID is also used in the creation of biologically active molecules, which can have applications in various therapeutic areas. Its structural features and reactivity contribute to the development of molecules with specific biological functions and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 850589-49-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,8 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 850589-49:
(8*8)+(7*5)+(6*0)+(5*5)+(4*8)+(3*9)+(2*4)+(1*9)=200
200 % 10 = 0
So 850589-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BClNO4/c13-10-7-8(12(16)17)1-2-9(10)11(15)14-3-5-18-6-4-14/h1-2,7,16-17H,3-6H2