850589-50-3 Usage
General Description
3-Chloro-4-(piperidine-1-carbonyl)phenylboronic acid is a chemical compound that belongs to the class of boronic acids. It is a white crystalline solid with the molecular formula C11H14BClNO3. 3-CHLORO-4-(PIPERIDINE-1-CARBONYL)PHENYLBORONIC ACID has potential applications in the field of organic chemistry, particularly in the synthesis of pharmaceuticals and agrochemicals. As a boronic acid derivative, it has the ability to form stable complexes with diols and other nucleophiles, making it useful in Suzuki-Miyaura cross-coupling reactions and other organic transformations. Additionally, the piperidine carbonyl group present in the molecule may also impart biological activity, making this compound of interest for medicinal chemistry research. Overall, 3-chloro-4-(piperidine-1-carbonyl)phenylboronic acid is a valuable building block for the synthesis of diverse organic compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 850589-50-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,8 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 850589-50:
(8*8)+(7*5)+(6*0)+(5*5)+(4*8)+(3*9)+(2*5)+(1*0)=193
193 % 10 = 3
So 850589-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H15BClNO3/c14-11-8-9(13(17)18)4-5-10(11)12(16)15-6-2-1-3-7-15/h4-5,8,17-18H,1-3,6-7H2
