850593-02-1 Usage
General Description
1-(4-Boronobenzoyl)piperidine-4-carboxylic acid is a chemical compound that contains a piperidine ring and a boronic acid functional group. It is commonly used in the synthesis of pharmaceutical compounds and organic materials due to its unique structural properties. 1-(4-BORONOBENZOYL)PIPERIDINE-4-CARBOXYLIC ACID has been studied for its potential applications in medicinal chemistry, particularly in the development of new drugs and biologically active molecules. Its boronic acid group also allows it to be used as a ligand in various catalytic processes, making it a valuable reagent in organic synthesis. Additionally, its piperidine ring structure gives it significant potential for biological activity and pharmacological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 850593-02-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,9 and 3 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 850593-02:
(8*8)+(7*5)+(6*0)+(5*5)+(4*9)+(3*3)+(2*0)+(1*2)=171
171 % 10 = 1
So 850593-02-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H16BNO5/c16-12(9-1-3-11(4-2-9)14(19)20)15-7-5-10(6-8-15)13(17)18/h1-4,10,19-20H,5-8H2,(H,17,18)
