85068-31-1 Usage
Uses
Used in Pharmaceutical Industry:
2',6'-Difluoropropiophenone is used as an organofluorine compound for its reactivity and biological activity, which is essential in the development of pharmaceuticals. Its unique properties may contribute to the synthesis of new drugs or the modification of existing ones to improve their efficacy and safety.
Used in Agrochemical Industry:
2',6'-Difluoropropiophenone is used as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity and biological activity can be harnessed to create more effective and environmentally friendly products for agricultural use.
Used in Specialty Materials Industry:
2',6'-Difluoropropiophenone is used as a building block in the development of specialty materials, such as advanced polymers and coatings. Its unique properties can enhance the performance and durability of these materials, making them suitable for various applications, including automotive, aerospace, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 85068-31-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,6 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 85068-31:
(7*8)+(6*5)+(5*0)+(4*6)+(3*8)+(2*3)+(1*1)=141
141 % 10 = 1
So 85068-31-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H8F2O/c1-2-8(12)9-6(10)4-3-5-7(9)11/h3-5H,2H2,1H3
