85092-83-7 Usage
Uses
Used in Pharmaceutical Industry:
1H-Indole, 3-bromo-5-methoxyis used as a building block in the synthesis of various organic compounds for pharmaceutical applications. Its unique structure and functional groups make it a valuable component in the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 1H-Indole, 3-bromo-5-methoxyis utilized as a precursor or intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its biological activity and chemical properties contribute to the effectiveness of these products.
Used in Material Science:
1H-Indole, 3-bromo-5-methoxyalso finds applications in material science, where it can be used to develop new materials with specific properties. Its chemical structure and reactivity make it a promising candidate for the synthesis of advanced materials with potential applications in various industries.
Used in Research and Development:
As a chemical compound with unique properties, 1H-Indole, 3-bromo-5-methoxyis commonly used in research and development for the exploration of new chemical reactions, synthesis methods, and potential applications. Its versatility and reactivity make it an essential tool for scientists and researchers in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 85092-83-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,9 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 85092-83:
(7*8)+(6*5)+(5*0)+(4*9)+(3*2)+(2*8)+(1*3)=147
147 % 10 = 7
So 85092-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNO/c1-12-6-2-3-9-7(4-6)8(10)5-11-9/h2-5,11H,1H3
