85099-06-5 Usage
Uses
Used in Pharmaceutical Research:
[(2-hydroxytetradecyl)thio]acetic acid is used as a drug delivery agent for enhancing the therapeutic effects of various medications. Its unique structure allows for controlled release of drugs in the body, potentially improving their efficacy and reducing side effects.
Used in Anti-inflammatory Applications:
In the field of medicine, [(2-hydroxytetradecyl)thio]acetic acid is used as an anti-inflammatory agent to help alleviate inflammation and associated pain. Its anti-inflammatory properties make it a potential candidate for the treatment of conditions characterized by chronic inflammation, such as arthritis and other autoimmune disorders.
Used in Antioxidant Applications:
[(2-hydroxytetradecyl)thio]acetic acid is also used as an antioxidant, protecting cells from damage caused by reactive oxygen species (ROS). Its antioxidant properties can be beneficial in the prevention and treatment of various diseases associated with oxidative stress, such as neurodegenerative disorders and cardiovascular diseases.
Used in Drug Development:
In the pharmaceutical industry, [(2-hydroxytetradecyl)thio]acetic acid is used as a starting material or intermediate in the synthesis of new drugs. Its unique chemical structure and properties make it a valuable component in the development of innovative therapeutic agents with improved efficacy and safety profiles.
Overall, [(2-hydroxytetradecyl)thio]acetic acid has demonstrated its potential as a versatile compound with a wide range of applications in medicine, including drug delivery, anti-inflammatory and antioxidant therapies, and drug development. Further research and development are necessary to fully understand its capabilities and optimize its use in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85099-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,9 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85099-06:
(7*8)+(6*5)+(5*0)+(4*9)+(3*9)+(2*0)+(1*6)=155
155 % 10 = 5
So 85099-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H32O3S/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-20-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)
