850991-53-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate is used as a synthetic intermediate for the development of various pharmaceuticals. Its unique structure allows it to be a key component in the creation of new drugs, potentially contributing to advancements in medicinal chemistry.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, Ethyl 6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate serves as an essential intermediate in the synthesis of a range of organic compounds. Its presence in these reactions can lead to the formation of complex molecules with diverse applications.
Used in Drug Development:
Due to its potential biological activity, Ethyl 6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate is utilized in drug development as a candidate for creating new therapeutic agents. Its incorporation into drug molecules could lead to the discovery of novel treatments for various medical conditions.
Used in Medicinal Chemistry Research:
Ethyl 6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate is also employed in medicinal chemistry research to explore its properties and potential applications. This research can provide valuable insights into the compound's interactions with biological systems and its role in the development of new pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 850991-53-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,9,9 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 850991-53:
(8*8)+(7*5)+(6*0)+(5*9)+(4*9)+(3*1)+(2*5)+(1*3)=196
196 % 10 = 6
So 850991-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO3/c1-2-14-10(13)11-5-7-3-8(6-11)9(12)4-7/h7-8H,2-6H2,1H3/t7-,8+/m0/s1
850991-53-6Relevant articles and documents
PHARMACEUTICAL COMPOSITIONS AND METHODS FOR RELIEVING PAIN AND TREATING CENTRAL NERVOUS SYSTEM DISORDERS
-
Page/Page column 82, (2008/06/13)
Patients susceptible to or suffering from disorders, such as central nervous system disorders, which are characterized by an alteration in normal neurotransmitter release, such as dopamine release (e.g., Parkinsonism, Parkinson's Disease, Tourette's Syndrome, attention deficient disorder, or schizophrenia), are treated by administering a compound of Formulas (1 or 2), as described herein. The compounds of Formulas (1 and 2) are also useful for treating pain, and treating drug addiction, nicotine addiction, and/or obesity. The compounds can exist as individual stereoisomers, racemic mixtures, diastereomers and the like.
