85117-72-2 Usage
Uses
Used in Pharmaceutical Industry:
2-amino-N-(2-bromoethyl)benzamide is utilized as a key intermediate in the synthesis of a range of organic compounds. Its presence in the molecular structure of target compounds contributes to their pharmacological properties, making it an essential component in the development of new pharmaceuticals.
Used in Research and Development:
In the fields of medicine and chemistry, 2-amino-N-(2-bromoethyl)benzamide serves as a valuable compound for research and development. Its unique structure allows scientists to explore its potential applications and interactions with biological systems, which can lead to the discovery of new therapeutic agents or chemical processes.
Used in Organic Synthesis:
As an organic compound with a reactive bromoethyl group and an amino group, 2-amino-N-(2-bromoethyl)benzamide is employed in organic synthesis for the preparation of various derivatives. Its reactivity and functional groups make it suitable for a wide range of chemical reactions, contributing to the synthesis of complex organic molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85117-72-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,1 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 85117-72:
(7*8)+(6*5)+(5*1)+(4*1)+(3*7)+(2*7)+(1*2)=132
132 % 10 = 2
So 85117-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BrN2O/c10-5-6-12-9(13)7-3-1-2-4-8(7)11/h1-4H,5-6,11H2,(H,12,13)
