85118-06-5 Usage
Uses
Used in Organic Synthesis:
2,5-Difluorobenzylamine is used as an amine building block for the synthesis of complex organic molecules through tandem Ugi/Diels-Alder reactions on soluble polymer support. This application allows for the efficient and selective construction of diverse molecular structures, which can be further utilized in pharmaceutical, agrochemical, and material science industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,5-Difluorobenzylamine is used as a key intermediate in the synthesis of various drug candidates. Its unique chemical properties, such as the presence of fluorine atoms, can impart specific biological activities and improve the pharmacokinetic properties of the resulting compounds.
Used in Agrochemical Industry:
2,5-Difluorobenzylamine is also utilized in the agrochemical industry for the development of novel pesticides and herbicides. The incorporation of fluorine atoms in these molecules can enhance their stability, selectivity, and efficacy against target pests or weeds.
Used in Material Science:
In the field of material science, 2,5-Difluorobenzylamine can be employed in the synthesis of advanced materials with specific properties, such as fluoropolymers, which exhibit excellent chemical resistance, thermal stability, and non-stick characteristics. These materials find applications in various industries, including automotive, aerospace, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 85118-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,1 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85118-06:
(7*8)+(6*5)+(5*1)+(4*1)+(3*8)+(2*0)+(1*6)=125
125 % 10 = 5
So 85118-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7F2N/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4,10H2/p+1
