85137-09-3 Usage
Uses
Used in Dye and Pigment Production:
4-ETHOXYBENZENE-1,2-DIAMINE is used as an intermediate in the synthesis of dyes and pigments for various applications, including textiles, plastics, and printing inks. Its aromatic structure and ethoxy group contribute to the color properties and stability of the resulting dyes and pigments.
Used in Polymer Synthesis:
In the polymer industry, 4-ETHOXYBENZENE-1,2-DIAMINE serves as a building block for the development of polymers with specific properties, such as improved solubility, reactivity, or stability. Its presence in the polymer chain can enhance the overall performance of the material in various applications.
Used in Pharmaceutical and Agricultural Industries:
4-ETHOXYBENZENE-1,2-DIAMINE is utilized as a precursor in the synthesis of pharmaceutical compounds and agrochemicals. Its reactivity and functional groups make it suitable for the development of active ingredients in drugs and pesticides, contributing to their efficacy and safety.
Used in Hair Dye and Hair Care Products:
In the cosmetic and personal care industry, 4-ETHOXYBENZENE-1,2-DIAMINE is used as a key component in hair dyes and hair care products. Its ability to react with hair proteins allows for effective coloration and conditioning, providing users with a range of hair care benefits.
Used in Photography:
4-ETHOXYBENZENE-1,2-DIAMINE finds applications in photographic processes, where it can be used to develop or enhance the images captured on photographic film or paper. Its chemical properties enable it to interact with light-sensitive materials, contributing to the formation of high-quality images.
Used as a Corrosion Inhibitor:
In certain industrial processes, 4-ETHOXYBENZENE-1,2-DIAMINE is employed as a corrosion inhibitor to protect metal surfaces from degradation and wear. Its ability to form protective layers on metal surfaces helps to prevent corrosion and extend the lifespan of equipment and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 85137-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,3 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 85137-09:
(7*8)+(6*5)+(5*1)+(4*3)+(3*7)+(2*0)+(1*9)=133
133 % 10 = 3
So 85137-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O.H2O4S/c1-2-11-6-3-4-7(9)8(10)5-6;1-5(2,3)4/h3-5H,2,9-10H2,1H3;(H2,1,2,3,4)
