851386-33-9 Usage
Uses
Used in Pharmaceutical Industry:
5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into drug molecules, potentially enhancing their efficacy and selectivity in treating diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID serves as a key intermediate in the development of new pesticides and other agrochemicals. Its incorporation into these compounds can improve their performance and selectivity, leading to more effective crop protection.
Used in Organic Synthesis:
5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID is utilized as an intermediate in the organic synthesis of a wide range of fine chemicals. Its reactivity and structural features make it a valuable component in the creation of complex organic molecules for various applications.
Used in Chemical Research:
As a pyridine derivative with fluorinated and carboxylic acid functional groups, 5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID is employed in chemical research to explore novel reactions and investigate the effects of fluorination on molecular properties. This research can lead to the discovery of new synthetic methods and applications for 5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID.
Physical Properties:
5,6-DIFLUORO PYRIDINE-3-CARBOXYLIC ACID is a white solid at room temperature, exhibiting solubility in organic solvents such as methanol and dichloromethane. This physical form and solubility profile facilitate its handling and use in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 851386-33-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,3,8 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 851386-33:
(8*8)+(7*5)+(6*1)+(5*3)+(4*8)+(3*6)+(2*3)+(1*3)=179
179 % 10 = 9
So 851386-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)
