851386-39-5 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Difluoropyridine-4-carboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with improved properties, such as enhanced bioavailability and targeted therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 2,5-Difluoropyridine-4-carboxylic acid serves as a crucial building block for the creation of novel agrochemicals, potentially leading to more effective and environmentally friendly pesticides and other agricultural products.
Used in Materials Science:
2,5-Difluoropyridine-4-carboxylic acid is applied in the field of materials science, where its unique structure and properties can be leveraged to develop new materials with specific characteristics for various applications.
Used as a Reagent in Organic Chemistry:
2,5-Difluoropyridine-4-carboxylic acid also functions as a reagent in organic chemistry reactions, facilitating specific transformations and syntheses that are otherwise challenging to achieve, thus broadening the scope of organic synthesis methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 851386-39-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,3,8 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 851386-39:
(8*8)+(7*5)+(6*1)+(5*3)+(4*8)+(3*6)+(2*3)+(1*9)=185
185 % 10 = 5
So 851386-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2NO2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2H,(H,10,11)
