851628-34-7 Usage
Description
4-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-BUTYRIC ACID is a chemical compound that features a butyric acid core, a 1,2,4-oxadiazole ring system, and a p-tolyl substitution. This molecular structure is known for its diverse pharmacological activities and potential therapeutic applications, particularly in the pharmaceutical industry.
Used in Pharmaceutical Industry:
4-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-BUTYRIC ACID is used as a research and development compound for its potential therapeutic applications. The 1,2,4-oxadiazole ring system contributes to its antimicrobial, antiviral, and anticancer properties, making it a valuable tool for drug discovery and chemical biology studies.
4-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-BUTYRIC ACID is also used as a key component in the development of novel pharmaceuticals with improved therapeutic effects. The p-tolyl substitution may enhance the compound's targeting and binding affinity to specific biological receptors, which can lead to more effective treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 851628-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,6,2 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 851628-34:
(8*8)+(7*5)+(6*1)+(5*6)+(4*2)+(3*8)+(2*3)+(1*4)=177
177 % 10 = 7
So 851628-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O3/c1-9-5-7-10(8-6-9)13-14-11(18-15-13)3-2-4-12(16)17/h5-8H,2-4H2,1H3,(H,16,17)