852180-67-7 Usage
Uses
Used in Organic Synthesis:
N-METHYL-N-(3-PYRIDIN-4-YLBENZYL)AMINE is used as a building block for the synthesis of complex organic molecules, leveraging its ability to participate in various chemical reactions. Its presence in the synthesis process allows for the creation of a broad range of compounds with potential applications across different industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, N-METHYL-N-(3-PYRIDIN-4-YLBENZYL)AMINE is used as an intermediate in drug development. Its unique structure and reactivity make it a valuable component in the formulation of new medications, particularly those targeting specific biological pathways or diseases.
Used in Chemical Reactions:
N-METHYL-N-(3-PYRIDIN-4-YLBENZYL)AMINE is utilized as a reactant in a variety of chemical reactions due to its heterocyclic amine nature. This allows chemists to explore its potential in creating new compounds with specific properties, further expanding its applications in research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 852180-67-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,1,8 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 852180-67:
(8*8)+(7*5)+(6*2)+(5*1)+(4*8)+(3*0)+(2*6)+(1*7)=167
167 % 10 = 7
So 852180-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2/c1-14-10-11-3-2-4-13(9-11)12-5-7-15-8-6-12/h2-9,14H,10H2,1H3
