852227-84-0 Usage
Uses
Used in Pharmaceutical Research:
N-Methyl-3-phenyl-5-isoxazolemethanamine hydrochloride is used as a research compound for exploring its pharmacological properties and potential therapeutic applications. Its unique structure and chemical properties make it a promising candidate for the development of new drugs targeting neurological disorders and mental health issues.
Used in Drug Development:
In the pharmaceutical industry, N-Methyl-3-phenyl-5-isoxazolemethanamine hydrochloride is utilized as a lead compound in the discovery and development of novel therapeutic agents. Its potential to modulate specific biological pathways and target receptors involved in various medical conditions makes it a valuable asset in the drug development process.
Used in Experimental Studies:
N-Methyl-3-phenyl-5-isoxazolemethanamine hydrochloride is employed as an experimental agent in various scientific studies. Researchers use N-Methyl-3-phenyl-5-isoxazolemethanaminehydrochloride to investigate its effects on cellular and molecular processes, as well as to understand its interactions with biological systems. This helps in elucidating the compound's mechanisms of action and identifying its potential therapeutic applications.
Used in Chemical Synthesis:
In the field of organic chemistry, N-Methyl-3-phenyl-5-isoxazolemethanamine hydrochloride serves as a key intermediate in the synthesis of more complex molecules and pharmaceutical agents. Its unique structure and reactivity make it a valuable building block for the development of new compounds with improved pharmacological properties and therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 852227-84-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,2,2 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 852227-84:
(8*8)+(7*5)+(6*2)+(5*2)+(4*2)+(3*7)+(2*8)+(1*4)=170
170 % 10 = 0
So 852227-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O.ClH/c1-12-8-10-7-11(13-14-10)9-5-3-2-4-6-9;/h2-7,12H,8H2,1H3;1H
