852228-14-9 Usage
Description
2,5-DIBROMOPYRIDINE-3-BORONIC ACID is a chemical compound characterized by the molecular formula C5H4BBr2N2O2. It is a boronic acid derivative that incorporates both bromine and boron atoms, making it a versatile component in various chemical processes and applications.
Uses
Used in Organic Synthesis:
2,5-DIBROMOPYRIDINE-3-BORONIC ACID is utilized as a key intermediate in organic synthesis for the creation of complex organic molecules. Its unique structure allows it to participate in a range of chemical reactions, providing a foundation for the development of new compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2,5-DIBROMOPYRIDINE-3-BORONIC ACID is employed as a building block for the synthesis of potential drug candidates. Its reactivity in reactions like the Suzuki-Miyaura coupling makes it valuable for constructing molecules with specific therapeutic properties.
Used in Agrochemical Production:
2,5-DIBROMOPYRIDINE-3-BORONIC ACID also finds application in the agrochemical sector, where it serves as a precursor in the synthesis of compounds with pesticidal or herbicidal activity. Its ability to form heterocyclic compounds and coordination complexes contributes to the creation of effective agrochemicals.
Used as a Reagent in Chemical Research:
In the realm of chemical research, 2,5-DIBROMOPYRIDINE-3-BORONIC ACID is used as a reagent to explore new reaction pathways and to understand the mechanisms of various chemical processes. Its role in the preparation of heterocyclic compounds and coordination complexes is particularly noteworthy for advancing scientific knowledge in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 852228-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,2,2 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 852228-14:
(8*8)+(7*5)+(6*2)+(5*2)+(4*2)+(3*8)+(2*1)+(1*4)=159
159 % 10 = 9
So 852228-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BBr2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
