852228-16-1 Usage
General Description
4-(2-chlorophenyl)piperazine-1-carboximidamide hydroiodide is a chemical compound that belongs to the class of piperazine derivatives. It is a hydroiodide salt form of the compound, which means it is the result of the reaction between the compound and hydroiodic acid. 4-(2-CHLOROPHENYL)PIPERAZINE-1-CARBOXIMIDAMIDE HYDROIODIDE has potential pharmacological applications due to its piperazine core structure, which has been found to have various biological activities. It is commonly used in medicinal chemistry research and drug discovery processes due to its potential as a central nervous system agent and its ability to modulate neurotransmitter function. Additionally, it has been studied for its potential antidepressant and anxiolytic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 852228-16-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,2,2 and 8 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 852228-16:
(8*8)+(7*5)+(6*2)+(5*2)+(4*2)+(3*8)+(2*1)+(1*6)=161
161 % 10 = 1
So 852228-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H15ClN4.HI/c12-9-3-1-2-4-10(9)15-5-7-16(8-6-15)11(13)14;/h1-4H,5-8H2,(H3,13,14);1H
