85223-05-8 Usage
Chemical class
Carbamate
Explanation
Different sources of media describe the Explanation of 85223-05-8 differently. You can refer to the following data:
1. 2-[[4-(2,2-dicyanovinyl)phenyl](2-phenylethyl)amino]ethyl (3,4-dichlorophenyl)carbamate is a chemical compound that belongs to the carbamate class, which consists of compounds with an ester-like linkage to an amine.
2. The core structure of the compound is a di-substituted phenyl ring, which means that it has two substituents attached to the benzene ring.
3. One of the substituents on the phenyl ring is a cyanovinyl group, which is a vinyl group (C=C) with two cyano groups (C≡N) attached to it.
4. Another substituent on the phenyl ring is an aminoethyl group, which is an ethylamine (NH2-CH2-CH3) attached to a phenyl ring (C6H5).
5. The carbamate group is attached to a 3,4-dichlorophenyl substituent, which is a phenyl ring with two chlorine atoms (Cl) attached at the 3rd and 4th positions.
6. Due to its unique structure and potential reactivity, 2-[[4-(2,2-dicyanovinyl)phenyl](2-phenylethyl)amino]ethyl (3,4-dichlorophenyl)carbamate may have applications in the field of pharmaceuticals and organic synthesis.
7. Since the specific properties and potential hazards of this compound are not detailed in this summary, it is important to handle 2-[[4-(2,2-dicyanovinyl)phenyl](2-phenylethyl)amino]ethyl (3,4-dichlorophenyl)carbamate with caution and in accordance with proper safety protocols.
Complex structure
Di-substituted phenyl ring
Cyanovinyl group
2,2-dicyanovinyl
Aminoethyl group
(2-phenylethyl)amino
3,4-dichlorophenyl substituent
(3,4-dichlorophenyl)carbamate
Potential applications
Pharmaceuticals and organic synthesis
Safety precautions
Handle with caution
Check Digit Verification of cas no
The CAS Registry Mumber 85223-05-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,2 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85223-05:
(7*8)+(6*5)+(5*2)+(4*2)+(3*3)+(2*0)+(1*5)=118
118 % 10 = 8
So 85223-05-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H22Cl2N4O2/c28-25-11-8-23(17-26(25)29)32-27(34)35-15-14-33(13-12-20-4-2-1-3-5-20)24-9-6-21(7-10-24)16-22(18-30)19-31/h1-11,16-17H,12-15H2,(H,32,34)