85223-07-0 Usage
Molecular structure
The chemical has a complex molecular structure with multiple functional groups and is an isoindole derivative.
Chloro (Cl)
A chlorine atom attached to a carbon atom.
Methoxy (OCH3)
An oxygen atom bonded to a methyl group.
Azo (N=N)
A nitrogen-nitrogen double bond, which is a common group in dyes and pigments.
Hydroxy (OH)
An oxygen atom bonded to a carbon atom with a hydrogen atom.
Carbonyl (C=O)
A carbon-oxygen double bond, which is a common functional group in organic compounds.
Amino (NH2)
A nitrogen atom bonded to two hydrogen atoms, which is a basic functional group found in amino acids.
Pharmacological properties
As an isoindole derivative, this compound has potential pharmacological properties, but its precise uses and properties require further analysis and testing.
Complexity
The chemical is a complex organic compound, indicating that it may have a wide range of interactions and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 85223-07-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,2 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 85223-07:
(7*8)+(6*5)+(5*2)+(4*2)+(3*3)+(2*0)+(1*7)=120
120 % 10 = 0
So 85223-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C47H28ClN5O8/c1-61-38-20-14-26(48)23-37(38)53-46(59)32-19-13-25(22-34(32)47(53)60)44(57)49-27-15-17-28(18-16-27)50-45(58)35-21-24-7-2-3-8-29(24)40(43(35)56)52-51-36-12-6-11-33-39(36)42(55)31-10-5-4-9-30(31)41(33)54/h2-23,51H,1H3,(H,49,57)(H,50,58)/b52-40-