85237-61-2 Usage
Chemical compound
2-acetamido-5-[[(phenylamino)carbonyl]amino]benzoic acid
Also known as
N-benzoyl-L-tyrosine
Structure
Amino acid derivative with a benzoyl group attached to the amino group of tyrosine
Applications
Potential inhibitor of lipid peroxidation
Potential anti-inflammatory effects
Synthesis of various compounds in organic chemistry
Versatility
Has potential applications in both academic and industrial research industries.
Check Digit Verification of cas no
The CAS Registry Mumber 85237-61-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,3 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 85237-61:
(7*8)+(6*5)+(5*2)+(4*3)+(3*7)+(2*6)+(1*1)=142
142 % 10 = 2
So 85237-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H15N3O4/c1-10(20)17-14-8-7-12(9-13(14)15(21)22)19-16(23)18-11-5-3-2-4-6-11/h2-9H,1H3,(H,17,20)(H,21,22)(H2,18,19,23)
