85281-85-2 Usage
Description
2,3-O-Cyclohexylidene-L(-)-erythruronicolactone is a chemical compound that serves as a key starting material in the synthesis of specific ligands and catalysts. It is characterized by its unique cyclohexylidene group and L-erythruronicolactone structure, which contribute to its reactivity and potential applications in various chemical processes.
Uses
Used in Chemical Synthesis:
2,3-O-Cyclohexylidene-L(-)-erythruronicolactone is used as a starting material for the preparation of (2R,3S)-1,4-bis(diphenylphosphino)butane-2,3-diol ligand. This ligand is crucial in the development of Rh(I) based catalysts, which are employed in the hydrogenation of olefins. The use of this compound allows for the creation of efficient and selective catalysts that can improve the outcomes of hydrogenation reactions in various chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 85281-85-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,8 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85281-85:
(7*8)+(6*5)+(5*2)+(4*8)+(3*1)+(2*8)+(1*5)=152
152 % 10 = 2
So 85281-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14O5/c11-8-6-7(9(12)13-8)15-10(14-6)4-2-1-3-5-10/h6-8,11H,1-5H2/t6-,7+,8?/m0/s1