853058-43-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is used as a building block for the synthesis of novel pharmaceutical compounds. Its unique structure and functional groups make it a versatile starting material for the development of new drugs targeting various diseases and conditions.
Used in Medicinal Chemistry Research:
4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is used as a research compound in medicinal chemistry to explore its potential applications and properties. Studies and research are ongoing to further understand its role in the development of new drugs and its interactions with biological targets.
Used in Drug Discovery:
4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is used in drug discovery processes to identify and develop new therapeutic agents. Its unique structure and functional groups provide opportunities for the design and synthesis of innovative drug candidates with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 853058-43-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,3,0,5 and 8 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 853058-43:
(8*8)+(7*5)+(6*3)+(5*0)+(4*5)+(3*8)+(2*4)+(1*3)=172
172 % 10 = 2
So 853058-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClN3O2/c8-6-5-4(10-2-11-6)3(1-9-5)7(12)13/h1-2,9H,(H,12,13)
853058-43-2Relevant academic research and scientific papers
Diazaindole-dicarbonyl-piperazinyl antiviral agents
-
Page/Page column 44, (2008/06/13)
The invention comprises substituted diazaindole-dicarbonyl-piperazinyl derivatives of general Formula I wherein: Q is selected from the group consisting of — may represent a bond; T is —C(O)— or —CH(CN)—; and —Y— is selected from the group consisting of compositions thereof and their use for treating HIV infection.
