85320-76-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(Aminocarbothioyl)pyridinium-1-olate is used as an antimicrobial agent for its potential to combat various types of bacteria. Its unique structure may contribute to its effectiveness in disrupting bacterial cell functions, thereby inhibiting their growth and proliferation.
Used in Antiviral Applications:
In the field of antiviral research, 3-(aminocarbothioyl)pyridinium-1-olate is utilized for its potential to inhibit viral replication and infectivity. Its mode of action could involve interfering with viral enzymes or binding to viral components, thus preventing the virus from infecting host cells.
Used as a Chelating Agent:
3-(Aminocarbothioyl)pyridinium-1-olate is used as a chelating agent for its ability to form complexes with metal ions. This property can be valuable in various chemical processes, including the removal of heavy metals from environmental samples or the stabilization of metal ions in chemical reactions.
Used in Organic Synthesis:
As a building block in organic synthesis, 3-(aminocarbothioyl)pyridinium-1-olate is used for the creation of a variety of organic molecules. Its versatile structure allows for the development of new compounds with potential applications in various fields, such as pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 85320-76-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,3,2 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85320-76:
(7*8)+(6*5)+(5*3)+(4*2)+(3*0)+(2*7)+(1*6)=129
129 % 10 = 9
So 85320-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2OS/c7-6(10)5-2-1-3-8(9)4-5/h1-4H,(H2,7,10)
