85345-74-0 Usage
Uses
Used in Pharmaceutical Research:
3-Chloro-2-fluorobenzoyl fluoride 98 is used as a reagent for the synthesis of various organic compounds, playing a crucial role in the development of new pharmaceuticals. Its unique properties allow for the creation of complex molecules that can be used in the treatment of various diseases and conditions.
Used in Agrochemical Production:
In the agrochemical industry, 3-chloro-2-fluorobenzoyl fluoride 98 is used as an intermediate in the production of various agrochemicals. Its reactive nature enables the synthesis of compounds that can be used in the development of pesticides, herbicides, and other agricultural products to improve crop yields and protect against pests.
Used in Dye Manufacturing:
3-Chloro-2-fluorobenzoyl fluoride 98 is also utilized in the dye industry as an intermediate for the synthesis of various dyes. Its ability to form complex organic compounds makes it a valuable component in the creation of dyes used in textiles, printing, and other applications.
Used in the Production of Fine Chemicals:
3-CHLORO-2-FLUOROBENZOYL FLUORIDE 98 is used as an intermediate in the production of fine chemicals, which are high-purity chemicals used in various industries such as pharmaceuticals, fragrances, and flavorings. The versatility of 3-chloro-2-fluorobenzoyl fluoride 98 allows for the synthesis of a wide range of fine chemicals with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85345-74-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,3,4 and 5 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 85345-74:
(7*8)+(6*5)+(5*3)+(4*4)+(3*5)+(2*7)+(1*4)=150
150 % 10 = 0
So 85345-74-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClF2O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H
