85391-67-9 Usage
Uses
Used in Agricultural Industry:
4-chloro-2-(3,4-dichlorophenoxy)benzothiazole is used as a fungicide for its effectiveness against a broad spectrum of plant pathogens. It functions by inhibiting fungal growth and preventing the spread of fungal infections in crops, thereby protecting plants and ensuring agricultural productivity.
Used in Pharmaceutical Development:
In the medical field, 4-chloro-2-(3,4-dichlorophenoxy)benzothiazole has potential applications in the development of new pharmaceuticals. Its unique chemical structure may offer novel therapeutic properties, contributing to advancements in medicine. However, further research and development are necessary to fully explore and understand its potential in this area.
It is crucial to handle 4-chloro-2-(3,4-dichlorophenoxy)benzothiazole with care due to its potential hazards if not properly managed and used.
Check Digit Verification of cas no
The CAS Registry Mumber 85391-67-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,3,9 and 1 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 85391-67:
(7*8)+(6*5)+(5*3)+(4*9)+(3*1)+(2*6)+(1*7)=159
159 % 10 = 9
So 85391-67-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H6Cl3NOS/c14-8-5-4-7(6-10(8)16)18-13-17-12-9(15)2-1-3-11(12)19-13/h1-6H
