85466-18-8 Usage
General Description
THYMOPOIETIN II (32-35) is a synthetic peptide that is designed to mimic the action of thymopoietin, a hormone that plays a crucial role in the development and function of T-cells in the immune system. The peptide consists of 4 amino acids and is known for its potential therapeutic applications in boosting immune function and promoting T-cell development. Research has shown that THYMOPOIETIN II (32-35) may have immune-enhancing effects, making it a potential candidate for the treatment of immune disorders and conditions where immune function needs to be improved. Additionally, it has been investigated for its potential role in cancer therapy, as it could potentially enhance the body's ability to recognize and destroy cancer cells. Overall, THYMOPOIETIN II (32-35) holds promise for various applications related to immune system regulation and T-cell function.
Check Digit Verification of cas no
The CAS Registry Mumber 85466-18-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,4,6 and 6 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 85466-18:
(7*8)+(6*5)+(5*4)+(4*6)+(3*6)+(2*1)+(1*8)=158
158 % 10 = 8
So 85466-18-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H40N8O7/c1-11(2)16(20(35)36)29-19(34)14(10-15(30)31)28-18(33)13(7-3-4-8-22)27-17(32)12(23)6-5-9-26-21(24)25/h11-14,16H,3-10,22-23H2,1-2H3,(H,27,32)(H,28,33)(H,29,34)(H,30,31)(H,35,36)(H4,24,25,26)/t12-,13-,14-,16-/m0/s1