85480-81-5 Usage
Molecular structure
The compound has a unique molecular structure that includes a pyrazole ring, a benz[de]isoquinoline ring, and a methoxy group.
Pharmaceutical and medicinal properties
The compound has potential pharmaceutical and medicinal properties due to its diverse structural features.
Therapeutic agent
It is used in research and drug development to explore its potential as a therapeutic agent for various diseases and conditions.
Industrial applications
The compound may have other industrial applications, but further research is needed to fully understand its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 85480-81-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,4,8 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 85480-81:
(7*8)+(6*5)+(5*4)+(4*8)+(3*0)+(2*8)+(1*1)=155
155 % 10 = 5
So 85480-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H15N3O3/c1-9-16(10(2)20-19-9)21-17(22)12-6-4-5-11-14(24-3)8-7-13(15(11)12)18(21)23/h4-8H,1-3H3,(H,19,20)