855222-19-4 Usage
Uses
Used in Pharmaceutical Research:
4-Hydroxy-2-(4-methoxy-phenyl)-butyronitrile is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential therapeutic applications. Its unique structure allows for the development of new drugs with various medicinal properties.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Hydroxy-2-(4-methoxy-phenyl)-butyronitrile is used as a building block for creating a wide range of organic compounds. Its versatility in chemical reactions makes it a valuable component in the synthesis of various molecules.
Used in Antioxidant and Anti-Inflammatory Applications:
4-Hydroxy-2-(4-methoxy-phenyl)-butyronitrile is used as an antioxidant and anti-inflammatory agent due to its potential to combat oxidative stress and reduce inflammation. This makes it a promising candidate for the development of treatments for various diseases and conditions associated with oxidative stress and inflammation.
Used in Chemical Research:
In the realm of chemical research, 4-Hydroxy-2-(4-methoxy-phenyl)-butyronitrile is employed as a subject of study to explore its chemical properties, reactivity, and potential applications in various chemical processes. This helps in expanding the understanding of its behavior and possible uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 855222-19-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,5,2,2 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 855222-19:
(8*8)+(7*5)+(6*5)+(5*2)+(4*2)+(3*2)+(2*1)+(1*9)=164
164 % 10 = 4
So 855222-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-14-11-4-2-9(3-5-11)10(8-12)6-7-13/h2-5,10,13H,6-7H2,1H3
