855308-65-5 Usage
Uses
Used in Chemical Synthesis:
4-(5-Chloro-2-thienyl)-2-Pyrimidinamine is used as a chemical intermediate for the synthesis of various complex organic compounds. Its unique structure, which includes a thiophene ring fused to a pyrimidine ring, makes it a valuable building block in the development of novel molecules with potential applications in different industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-(5-Chloro-2-thienyl)-2-Pyrimidinamine is used as a starting material for the development of new drugs. Its structure may provide a basis for the design of molecules with specific biological activities, such as antimicrobial, antiviral, or anticancer properties. Further research and testing would be necessary to explore its potential as a therapeutic agent.
Used in Material Science:
4-(5-Chloro-2-thienyl)-2-Pyrimidinamine may also find applications in material science, particularly in the development of new materials with unique electronic, optical, or mechanical properties. Its incorporation into polymers or other materials could lead to the creation of novel composites with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 855308-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,5,3,0 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 855308-65:
(8*8)+(7*5)+(6*5)+(5*3)+(4*0)+(3*8)+(2*6)+(1*5)=185
185 % 10 = 5
So 855308-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3S/c9-7-2-1-6(13-7)5-3-4-11-8(10)12-5/h1-4H,(H2,10,11,12)
