855423-33-5 Usage
Uses
Used in Pharmaceutical Industry:
4-(Pyrimidin-2-yloxy)benzoic acid is used as a building block for the synthesis of various pharmaceuticals and biologically active molecules. Its unique structure allows it to be incorporated into drug candidates for the treatment of various diseases and conditions.
Used in Medicinal Chemistry Research:
4-(Pyrimidin-2-yloxy)benzoic acid is used as a research tool in medicinal chemistry to explore its potential applications in the development of new drugs. Its precise properties and specific uses may vary depending on the context and the specific chemical and biological characteristics of the target compounds being synthesized.
Check Digit Verification of cas no
The CAS Registry Mumber 855423-33-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,5,4,2 and 3 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 855423-33:
(8*8)+(7*5)+(6*5)+(5*4)+(4*2)+(3*3)+(2*3)+(1*3)=175
175 % 10 = 5
So 855423-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O3/c14-10(15)8-2-4-9(5-3-8)16-11-12-6-1-7-13-11/h1-7H,(H,14,15)