85567-40-4 Usage
Uses
Used in Chemical Industry:
2,3-Bis(2,5-dimethylphenoxy)propan-1-ol is used as a starting material for the synthesis of various organic compounds, contributing to the development of new chemical entities and products.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, 2,3-Bis(2,5-dimethylphenoxy)propan-1-ol is used as a precursor for the production of pharmaceuticals, playing a crucial role in the creation of medicinal compounds.
Used in Pesticide Production:
2,3-Bis(2,5-dimethylphenoxy)propan-1-ol also serves as a precursor in the manufacturing process of pesticides, aiding in the development of agricultural chemicals to protect crops.
Used as an Antioxidant:
2,3-Bis(2,5-dimethylphenoxy)propan-1-ol is used as an antioxidant in various products, helping to prevent oxidation and extend the shelf life of certain goods.
Used as a Preservative:
Additionally, it is utilized as a preservative in different products to maintain their quality and prevent spoilage over time.
Check Digit Verification of cas no
The CAS Registry Mumber 85567-40-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,5,6 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85567-40:
(7*8)+(6*5)+(5*5)+(4*6)+(3*7)+(2*4)+(1*0)=164
164 % 10 = 4
So 85567-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H24O3/c1-13-5-7-15(3)18(9-13)21-12-17(11-20)22-19-10-14(2)6-8-16(19)4/h5-10,17,20H,11-12H2,1-4H3
