85589-69-1 Usage
Uses
Used in Pharmaceutical Industry:
1-chloronaphtho[2,1-b]thiophene-2-carboxylic acid is used as a building block for the synthesis of various pharmaceutical compounds due to its unique structure and functional group. Its presence in the molecular framework can influence the pharmacological properties of the resulting compounds, making it a valuable component in drug development.
Used in Organic Synthesis:
In the field of organic synthesis, 1-chloronaphtho[2,1-b]thiophene-2-carboxylic acid serves as a versatile intermediate for the creation of a range of organic molecules. Its carboxylic acid group can participate in various chemical reactions, such as esterification, amidation, and condensation, facilitating the synthesis of complex organic compounds for diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85589-69-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,5,8 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 85589-69:
(7*8)+(6*5)+(5*5)+(4*8)+(3*9)+(2*6)+(1*9)=191
191 % 10 = 1
So 85589-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H7ClO2S/c14-11-10-8-4-2-1-3-7(8)5-6-9(10)17-12(11)13(15)16/h1-6H,(H,15,16)
85589-69-1Relevant academic research and scientific papers
Sidorenko, T. N.,Terent'eva, G. A.,Andrienko, O. S.,Savinykh, Yu. V.,Aksenov, V. S.
, p. 156 - 160 (1983)
A new method for the preparation of naphtho- and naphthothiophene structures by arylation of acrylic acid with α- and β-iodonaphthalene and subsequent oxidation of the resulting trans-naphthylacrylic acids with thionyl chloride in the presence of triethylbenzylammonium chloride is proposed.
