85600-56-2 Usage
General Description
1,1′-Biphenyl, 4,4′-bis(trans-4-propylcyclohexyl)- is a chemical compound commonly known as BPhPCH. It is a member of the liquid crystal family and is used in the production of liquid crystal displays (LCDs). BPhPCH is known for its ability to align liquid crystal molecules in a specific direction, which is essential for the functioning of LCDs. It has a high thermal stability and low viscosity, making it a suitable material for various electronic applications. BPhPCH is also used in the manufacturing of optical films, protective coatings, and other electronic devices. Additionally, it has potential applications in the development of advanced materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 85600-56-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,6,0 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85600-56:
(7*8)+(6*5)+(5*6)+(4*0)+(3*0)+(2*5)+(1*6)=132
132 % 10 = 2
So 85600-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C30H42/c1-3-5-23-7-11-25(12-8-23)27-15-19-29(20-16-27)30-21-17-28(18-22-30)26-13-9-24(6-4-2)10-14-26/h15-26H,3-14H2,1-2H3/t23-,24?,25-,26?