856167-47-0 Usage
Uses
Used in Pharmaceutical Industry:
3-Iodo-4-isopropoxybenzoic acid serves as an intermediate in the synthesis of various pharmaceuticals. Its unique structure, including the iodo functional group, facilitates its role in the development of new drugs and medicinal compounds, contributing to advancements in healthcare and medicine.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Iodo-4-isopropoxybenzoic acid is utilized as a precursor in the production of agrochemicals. Its chemical properties make it suitable for the synthesis of compounds used in crop protection and other agricultural applications, thereby supporting agricultural productivity and food security.
Used in Organic Synthesis:
3-Iodo-4-isopropoxybenzoic acid is employed as a versatile intermediate in organic synthesis across different industries. Its reactivity and functional groups enable the creation of a wide array of organic compounds for various applications, including but not limited to, specialty chemicals, materials science, and research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 856167-47-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,6,1,6 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 856167-47:
(8*8)+(7*5)+(6*6)+(5*1)+(4*6)+(3*7)+(2*4)+(1*7)=200
200 % 10 = 0
So 856167-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11IO3/c1-6(2)14-9-4-3-7(10(12)13)5-8(9)11/h3-6H,1-2H3,(H,12,13)