856600-01-6 Usage
General Description
4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate is a chemical compound that contains a pyrrolopyrimidine ring system with an amino group. The hydrogen sulfate (sulfuric acid) serves as the counterion. 4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate has potential applications in the pharmaceutical industry as it may act as a precursor or intermediate in the synthesis of various pharmaceutical compounds. It is also used in organic synthesis and chemical research as a building block for the creation of novel molecules. Additionally, it may have potential biological activities and could be investigated for its pharmacological properties. Overall, 4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate is a versatile chemical with potential uses in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 856600-01-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,6,6,0 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 856600-01:
(8*8)+(7*5)+(6*6)+(5*6)+(4*0)+(3*0)+(2*0)+(1*1)=166
166 % 10 = 6
So 856600-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4S.H2O4S/c7-5-4-3(1-2-8-4)9-6(11)10-5;1-5(2,3)4/h1-2,8H,(H3,7,9,10,11);(H2,1,2,3,4)