85665-50-5 Usage
Chemical class
Tetraazamacrocycles
Structure
Hydroxy group at the 15th position and a nitrile group at the 16th position
Applications
Coordination chemistry, medicinal chemistry, development of new ligands for catalytic processes, and synthesis of complex organic molecules
Metal complex formation
Ability to form stable metal complexes
Biological activity
Potential biological activity
Versatility
Important chemical compound with potential applications in various fields of science and technology
Check Digit Verification of cas no
The CAS Registry Mumber 85665-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,6,6 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85665-50:
(7*8)+(6*5)+(5*6)+(4*6)+(3*5)+(2*5)+(1*0)=165
165 % 10 = 5
So 85665-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H27N5O/c1-12(18)11-17-10-9-16-8-7-15-6-5-14-4-2-3-13/h12,14-18H,2,4-11H2,1H3