85665-75-4 Usage
Type
chemical compound
Contains a dimethylamino group
nitrogen atom bonded to two methyl groups
Contains a phenoxy group
benzene ring bonded to an oxygen atom
Commonly used as a pharmaceutical intermediate
Used in the production of various drugs and compounds
Used in organic synthesis and as a reagent in chemical reactions
Potential applications in medicine and biotechnology due to its structural characteristics and properties
Check Digit Verification of cas no
The CAS Registry Mumber 85665-75-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,6,6 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85665-75:
(7*8)+(6*5)+(5*6)+(4*6)+(3*5)+(2*7)+(1*5)=174
174 % 10 = 4
So 85665-75-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO2/c1-12(2)10-4-6-11(7-5-10)14-9-3-8-13/h4-7,13H,3,8-9H2,1-2H3
