856758-56-0 Usage
General Description
Benzenemethanamine, 4-ethoxy-alpha-methyl-, (aR)- is an organic chemical compound with the molecular formula C10H15NO. It is a chiral compound with a unique three-dimensional structure. Benzenemethanamine, 4-ethoxy-a-methyl-, (aR)- is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and pharmaceuticals. Its chemical properties make it suitable for use in the development of new drug candidates and therapeutic agents. It is also used as an intermediate in the production of other organic compounds. Additionally, it has potential applications in the field of medicinal chemistry and drug discovery. Overall, this chemical compound plays a crucial role in the development of pharmaceutical products and related industries.
Check Digit Verification of cas no
The CAS Registry Mumber 856758-56-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,6,7,5 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 856758-56:
(8*8)+(7*5)+(6*6)+(5*7)+(4*5)+(3*8)+(2*5)+(1*6)=230
230 % 10 = 0
So 856758-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO/c1-3-12-10-6-4-9(5-7-10)8(2)11/h4-8H,3,11H2,1-2H3/t8-/m1/s1
