85709-86-0 Usage
Uses
Used in Organic Synthesis:
(2-(3,4-dimethoxyphenyl)ethyl)dimethylselenonium is used as a reagent in organic synthesis for its ability to transfer selenium atoms to organic molecules. This property allows for the formation of new compounds and the modification of existing ones, making it a valuable tool in the development of new chemical products.
Used in Chemical Processes:
DMPPEDS is used as a catalyst in various chemical reactions, facilitating the formation of desired products and improving the efficiency of the reaction process. Its unique reactivity makes it a useful component in the synthesis of complex organic molecules.
Used in Pharmaceutical Applications:
(2-(3,4-dimethoxyphenyl)ethyl)dimethylselenonium has been studied for its potential pharmaceutical applications, particularly in the development of anticancer and antioxidant treatments. Its selenium content and reactivity may contribute to its therapeutic effects, making it a promising candidate for further research and development in the medical field.
Used in Selenium Chemistry Research:
Due to its unique molecular structure and reactivity, DMPPEDS is a subject of interest in the field of selenium chemistry. Researchers are exploring its properties and potential applications to gain a deeper understanding of selenium compounds and their role in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 85709-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,0 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85709-86:
(7*8)+(6*5)+(5*7)+(4*0)+(3*9)+(2*8)+(1*6)=170
170 % 10 = 0
So 85709-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H19O2Se.HI/c1-13-11-6-5-10(7-8-15(3)4)9-12(11)14-2;/h5-6,9H,7-8H2,1-4H3;1H/q+1;/p-1
85709-86-0Relevant academic research and scientific papers
New selenium-75 labeled radiopharmaceuticals: Selenonium analogues of dopamine
Sadek,Basmadjian,Hsu,Rieger
, p. 947 - 950 (2007/10/02)
Selenium-75 labeled selenonium analogues of dopamine, [2-(3,4-dimethoxyphenyl)ethyl]dimethylselenonium iodide (4) and its dihydroxy analogue (7), were prepared by reducing [75Se]selenious acid with sodium borohydride at pH 6.0 and reacting the
