857243-06-2 Usage
General Description
2-piperidin-1-ylbutan-1-amine, also known as N-butylpiperidine, is a chemical compound with the molecular formula C10H22N2. It is a tertiary amine and is used as a building block in organic synthesis. 2-piperidin-1-ylbutan-1-amine is often used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It is also used in research and development processes for the synthesis of new chemical compounds. Additionally, 2-piperidin-1-ylbutan-1-amine has potential applications in the production of agrochemicals and specialty chemicals. Overall, this chemical compound plays a significant role in the development of various products and compounds in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 857243-06-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,4 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 857243-06:
(8*8)+(7*5)+(6*7)+(5*2)+(4*4)+(3*3)+(2*0)+(1*6)=182
182 % 10 = 2
So 857243-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H20N2/c1-2-9(8-10)11-6-4-3-5-7-11/h9H,2-8,10H2,1H3
